C15H22N2O4 — CID 115293945
4-amino-N-(4-ethoxy-3-methoxyphenyl)oxane-4-carboxamide (PubChem CID 115293945) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-amino-N-(4-ethoxy-3-methoxyphenyl)oxane-4-carboxamide.
| Compound Name | 4-amino-N-(4-ethoxy-3-methoxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 115293945 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-amino-N-(4-ethoxy-3-methoxyphenyl)oxane-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2(N)CCOCC2)cc1OC |
| InChI | InChI=1S/C15H22N2O4/c1-3-21-12-5-4-11(10-13(12)19-2)17-14(18)15(16)6-8-20-9-7-15/h4-5,10H,3,6-9,16H2,1-2H3,(H,17,18) |
| InChIKey | CZWRZFGXXVKNAD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |