C14H17Cl2NO3 — CID 39911745
(1S)-2,2-dichloro-N-(4-ethoxy-3-methoxyphenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 39911745) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-(4-ethoxy-3-methoxyphenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-(4-ethoxy-3-methoxyphenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 39911745 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (1S)-2,2-dichloro-N-(4-ethoxy-3-methoxyphenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@]2(C)CC2(Cl)Cl)cc1OC |
| InChI | InChI=1S/C14H17Cl2NO3/c1-4-20-10-6-5-9(7-11(10)19-3)17-12(18)13(2)8-14(13,15)16/h5-7H,4,8H2,1-3H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | FGEYTVHTXWQLKX-ZDUSSCGKSA-N |
| XLogP | 3.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|