C14H18ClN3O3 — CID 115293893
N-(4-acetamido-3-chlorophenyl)-4-aminooxane-4-carboxamide (PubChem CID 115293893) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is N-(4-acetamido-3-chlorophenyl)-4-aminooxane-4-carboxamide.
| Compound Name | N-(4-acetamido-3-chlorophenyl)-4-aminooxane-4-carboxamide |
|---|---|
| PubChem CID | 115293893 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-(4-acetamido-3-chlorophenyl)-4-aminooxane-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C2(N)CCOCC2)cc1Cl |
| InChI | InChI=1S/C14H18ClN3O3/c1-9(19)17-12-3-2-10(8-11(12)15)18-13(20)14(16)4-6-21-7-5-14/h2-3,8H,4-7,16H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | TXBWYLSAQZLUIX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |