C16H19Cl3N2O — CID 26209054
(1S)-2,2-dichloro-N-(5-chloro-2-piperidin-1-ylphenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 26209054) has the molecular formula C16H19Cl3N2O and a molecular weight of 361.70 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-(5-chloro-2-piperidin-1-ylphenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-(5-chloro-2-piperidin-1-ylphenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 26209054 |
| Molecular Formula | C16H19Cl3N2O |
| Molecular Weight | 361.70 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (1S)-2,2-dichloro-N-(5-chloro-2-piperidin-1-ylphenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@]1(C(=O)Nc2cc(Cl)ccc2N2CCCCC2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H19Cl3N2O/c1-15(10-16(15,18)19)14(22)20-12-9-11(17)5-6-13(12)21-7-3-2-4-8-21/h5-6,9H,2-4,7-8,10H2,1H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | HSCFRKGRTSLKAQ-HNNXBMFYSA-N |
| XLogP | 4.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|