C17H20Cl2N2O2 — CID 30093775
(1S)-2,2-dichloro-1-methyl-N-[2-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 30093775) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.27 g/mol. Its IUPAC name is (1S)-2,2-dichloro-1-methyl-N-[2-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-1-methyl-N-[2-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 30093775 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (1S)-2,2-dichloro-1-methyl-N-[2-(piperidine-1-carbonyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | C[C@@]1(C(=O)Nc2ccccc2C(=O)N2CCCCC2)CC1(Cl)Cl |
| InChI | InChI=1S/C17H20Cl2N2O2/c1-16(11-17(16,18)19)15(23)20-13-8-4-3-7-12(13)14(22)21-9-5-2-6-10-21/h3-4,7-8H,2,5-6,9-11H2,1H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | UWKCVYUWTDXQGO-INIZCTEOSA-N |
| XLogP | 3.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|