C18H26ClN3O — CID 18082339
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]cyclohexanecarboxamide (PubChem CID 18082339) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18082339 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]cyclohexanecarboxamide |
| SMILES | CN1CCN(c2ccc(Cl)cc2NC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H26ClN3O/c1-21-9-11-22(12-10-21)17-8-7-15(19)13-16(17)20-18(23)14-5-3-2-4-6-14/h7-8,13-14H,2-6,9-12H2,1H3,(H,20,23) |
| InChIKey | IAMHMYFANWFKBY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |