C15H17Cl2N3O4 — CID 17388460
ethyl 4-[[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]carbamoylamino]benzoate (PubChem CID 17388460) has the molecular formula C15H17Cl2N3O4 and a molecular weight of 374.22 g/mol. Its IUPAC name is ethyl 4-[[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 17388460 |
| Molecular Formula | C15H17Cl2N3O4 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | ethyl 4-[[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NNC(=O)C2(C)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H17Cl2N3O4/c1-3-24-11(21)9-4-6-10(7-5-9)18-13(23)20-19-12(22)14(2)8-15(14,16)17/h4-7H,3,8H2,1-2H3,(H,19,22)(H2,18,20,23) |
| InChIKey | RNQXJZSETWXFBW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|