C12H12Cl2N2O2S — CID 110190236
2,2-dichloro-N-[(4-hydroxyphenyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 110190236) has the molecular formula C12H12Cl2N2O2S and a molecular weight of 319.21 g/mol. Its IUPAC name is 2,2-dichloro-N-[(4-hydroxyphenyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[(4-hydroxyphenyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110190236 |
| Molecular Formula | C12H12Cl2N2O2S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2,2-dichloro-N-[(4-hydroxyphenyl)carbamothioyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NC(=S)Nc2ccc(O)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H12Cl2N2O2S/c1-11(6-12(11,13)14)9(18)16-10(19)15-7-2-4-8(17)5-3-7/h2-5,17H,6H2,1H3,(H2,15,16,18,19) |
| InChIKey | NTRXJZOJPFRMLI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|