C12H11BrCl2N2OS — CID 2375668
(1S)-N-[(2-bromophenyl)carbamothioyl]-2,2-dichloro-1-methylcyclopropane-1-carboxamide (PubChem CID 2375668) has the molecular formula C12H11BrCl2N2OS and a molecular weight of 382.11 g/mol. Its IUPAC name is (1S)-N-[(2-bromophenyl)carbamothioyl]-2,2-dichloro-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[(2-bromophenyl)carbamothioyl]-2,2-dichloro-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2375668 |
| Molecular Formula | C12H11BrCl2N2OS |
| Molecular Weight | 382.11 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | (1S)-N-[(2-bromophenyl)carbamothioyl]-2,2-dichloro-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@]1(C(=O)NC(=S)Nc2ccccc2Br)CC1(Cl)Cl |
| InChI | InChI=1S/C12H11BrCl2N2OS/c1-11(6-12(11,14)15)9(18)17-10(19)16-8-5-3-2-4-7(8)13/h2-5H,6H2,1H3,(H2,16,17,18,19)/t11-/m0/s1 |
| InChIKey | SOUJAUUWJCFYPJ-NSHDSACASA-N |
| XLogP | 3.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.11 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|