C13H14Cl2N2OS — CID 110190354
2,2-dichloro-1-methyl-N-[(3-methylphenyl)carbamothioyl]cyclopropane-1-carboxamide (PubChem CID 110190354) has the molecular formula C13H14Cl2N2OS and a molecular weight of 317.24 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-[(3-methylphenyl)carbamothioyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-[(3-methylphenyl)carbamothioyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110190354 |
| Molecular Formula | C13H14Cl2N2OS |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-[(3-methylphenyl)carbamothioyl]cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(NC(=S)NC(=O)C2(C)CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2OS/c1-8-4-3-5-9(6-8)16-11(19)17-10(18)12(2)7-13(12,14)15/h3-6H,7H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | OWECZTAAHPKUFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|