C16H16N2O2S — CID 19649080
2-[4-[(3-methylphenyl)carbamothioylamino]phenyl]acetic acid (PubChem CID 19649080) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[4-[(3-methylphenyl)carbamothioylamino]phenyl]acetic acid.
| Compound Name | 2-[4-[(3-methylphenyl)carbamothioylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 19649080 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[4-[(3-methylphenyl)carbamothioylamino]phenyl]acetic acid |
| SMILES | Cc1cccc(NC(=S)Nc2ccc(CC(=O)O)cc2)c1 |
| InChI | InChI=1S/C16H16N2O2S/c1-11-3-2-4-14(9-11)18-16(21)17-13-7-5-12(6-8-13)10-15(19)20/h2-9H,10H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | KXDWQAWAXODSHT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|