C21H19N3OS — CID 17235513
2-phenyl-N-[3-(phenylcarbamothioylamino)phenyl]acetamide (PubChem CID 17235513) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-phenyl-N-[3-(phenylcarbamothioylamino)phenyl]acetamide.
| Compound Name | 2-phenyl-N-[3-(phenylcarbamothioylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 17235513 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-phenyl-N-[3-(phenylcarbamothioylamino)phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1)Nc1cccc(NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C21H19N3OS/c25-20(14-16-8-3-1-4-9-16)22-18-12-7-13-19(15-18)24-21(26)23-17-10-5-2-6-11-17/h1-13,15H,14H2,(H,22,25)(H2,23,24,26) |
| InChIKey | LTFJWIBDZRXBLD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|