C9H9Cl2N3OS2 — CID 2396662
(1S)-2,2-dichloro-1-methyl-N-(1,3-thiazol-2-ylcarbamothioyl)cyclopropane-1-carboxamide (PubChem CID 2396662) has the molecular formula C9H9Cl2N3OS2 and a molecular weight of 310.23 g/mol. Its IUPAC name is (1S)-2,2-dichloro-1-methyl-N-(1,3-thiazol-2-ylcarbamothioyl)cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-1-methyl-N-(1,3-thiazol-2-ylcarbamothioyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2396662 |
| Molecular Formula | C9H9Cl2N3OS2 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | (1S)-2,2-dichloro-1-methyl-N-(1,3-thiazol-2-ylcarbamothioyl)cyclopropane-1-carboxamide |
| SMILES | C[C@@]1(C(=O)NC(=S)Nc2nccs2)CC1(Cl)Cl |
| InChI | InChI=1S/C9H9Cl2N3OS2/c1-8(4-9(8,10)11)5(15)13-6(16)14-7-12-2-3-17-7/h2-3H,4H2,1H3,(H2,12,13,14,15,16)/t8-/m0/s1 |
| InChIKey | GGHMEHBEXGXIDF-QMMMGPOBSA-N |
| XLogP | 2.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|