C12H21N3S2 — CID 117060575
1-(1,3-thiazol-2-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 117060575) has the molecular formula C12H21N3S2 and a molecular weight of 271.45 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-(1,3-thiazol-2-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 117060575 |
| Molecular Formula | C12H21N3S2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)(C)CC(C)(C)NC(=S)Nc1nccs1 |
| InChI | InChI=1S/C12H21N3S2/c1-11(2,3)8-12(4,5)15-9(16)14-10-13-6-7-17-10/h6-7H,8H2,1-5H3,(H2,13,14,15,16) |
| InChIKey | LYNKOTLAVGUBAW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|