C6H6N2OS3 — CID 130012413
2-oxoethyl N-(1,3-thiazol-2-yl)carbamodithioate (PubChem CID 130012413) has the molecular formula C6H6N2OS3 and a molecular weight of 218.33 g/mol. Its IUPAC name is 2-oxoethyl N-(1,3-thiazol-2-yl)carbamodithioate.
| Compound Name | 2-oxoethyl N-(1,3-thiazol-2-yl)carbamodithioate |
|---|---|
| PubChem CID | 130012413 |
| Molecular Formula | C6H6N2OS3 |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 217.96 |
| IUPAC Name | 2-oxoethyl N-(1,3-thiazol-2-yl)carbamodithioate |
| SMILES | O=CCSC(=S)Nc1nccs1 |
| InChI | InChI=1S/C6H6N2OS3/c9-2-4-12-6(10)8-5-7-1-3-11-5/h1-3H,4H2,(H,7,8,10) |
| InChIKey | SYANUFXSRIDBMS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|