C10H19N3S3 — CID 12657202
N,N-diethylethanamine;1,3-thiazol-2-ylcarbamodithioic acid (PubChem CID 12657202) has the molecular formula C10H19N3S3 and a molecular weight of 277.48 g/mol. Its IUPAC name is N,N-diethylethanamine;1,3-thiazol-2-ylcarbamodithioic acid.
| Compound Name | N,N-diethylethanamine;1,3-thiazol-2-ylcarbamodithioic acid |
|---|---|
| PubChem CID | 12657202 |
| Molecular Formula | C10H19N3S3 |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N,N-diethylethanamine;1,3-thiazol-2-ylcarbamodithioic acid |
| SMILES | CCN(CC)CC.S=C(S)Nc1nccs1 |
| InChI | InChI=1S/C6H15N.C4H4N2S3/c1-4-7(5-2)6-3;7-4(8)6-3-5-1-2-9-3/h4-6H2,1-3H3;1-2H,(H2,5,6,7,8) |
| InChIKey | BAUDWVIJAFXHAF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|