C4H3MoN2S3- — CID 174708139
molybdenum;N-(1,3-thiazol-2-yl)carbamodithioate (PubChem CID 174708139) has the molecular formula C4H3MoN2S3- and a molecular weight of 271.22 g/mol. Its IUPAC name is molybdenum;N-(1,3-thiazol-2-yl)carbamodithioate.
| Compound Name | molybdenum;N-(1,3-thiazol-2-yl)carbamodithioate |
|---|---|
| PubChem CID | 174708139 |
| Molecular Formula | C4H3MoN2S3- |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 272.85 |
| IUPAC Name | molybdenum;N-(1,3-thiazol-2-yl)carbamodithioate |
| SMILES | S=C([S-])Nc1nccs1.[Mo] |
| InChI | InChI=1S/C4H4N2S3.Mo/c7-4(8)6-3-5-1-2-9-3;/h1-2H,(H2,5,6,7,8);/p-1 |
| InChIKey | MDQNYQXQIQYTGZ-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|