C15H19N3O2S2 — CID 22923229
1-[2-(3-ethoxy-4-methoxyphenyl)ethyl]-3-(1,3-thiazol-2-yl)thiourea (PubChem CID 22923229) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-[2-(3-ethoxy-4-methoxyphenyl)ethyl]-3-(1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-[2-(3-ethoxy-4-methoxyphenyl)ethyl]-3-(1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 22923229 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-[2-(3-ethoxy-4-methoxyphenyl)ethyl]-3-(1,3-thiazol-2-yl)thiourea |
| SMILES | CCOc1cc(CCNC(=S)Nc2nccs2)ccc1OC |
| InChI | InChI=1S/C15H19N3O2S2/c1-3-20-13-10-11(4-5-12(13)19-2)6-7-16-14(21)18-15-17-8-9-22-15/h4-5,8-10H,3,6-7H2,1-2H3,(H2,16,17,18,21) |
| InChIKey | VZFPLDINLYWRNL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|