C14H15BrCl2N2O2 — CID 46563598
N-[2-(2-bromoanilino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide (PubChem CID 46563598) has the molecular formula C14H15BrCl2N2O2 and a molecular weight of 394.10 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46563598 |
| Molecular Formula | C14H15BrCl2N2O2 |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)C(=O)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C14H15BrCl2N2O2/c1-13(8-14(13,16)17)12(21)19(2)7-11(20)18-10-6-4-3-5-9(10)15/h3-6H,7-8H2,1-2H3,(H,18,20) |
| InChIKey | PTXGQNHJUNOMCQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|