About (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane
(1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane (PubChem CID 142872108) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane.
Molecular Properties
| Compound Name | (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane |
| PubChem CID | 142872108 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane |
| SMILES | CC.CC(C)C1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C12H20.C2H6/c1-8(2)10-6-5-9-7-11(10)12(9,3)4;1-2/h6,8-9,11H,5,7H2,1-4H3;1-2H3/t9-,11-;/m0./s1 |
| InChIKey | ZYAFXWBFOXKRLR-ROLPUNSJSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane?
The IUPAC name of (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane (CID 142872108) is (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane.
What is the SMILES notation for (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane?
The canonical SMILES for (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane is CC.CC(C)C1=CC[C@H]2C[C@@H]1C2(C)C.
What is the InChIKey of (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane?
The InChIKey is ZYAFXWBFOXKRLR-ROLPUNSJSA-N. The full InChI is InChI=1S/C12H20.C2H6/c1-8(2)10-6-5-9-7-11(10)12(9,3)4;1-2/h6,8-9,11H,5,7H2,1-4H3;1-2H3/t9-,11-;/m0./s1.
What are the key properties of (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane?
(1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane has a molecular weight of 194.36 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane is sourced from PubChem (CID 142872108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).