C14H26 — CID 142872108
(1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane (PubChem CID 142872108) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane.
| Compound Name | (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane |
|---|---|
| PubChem CID | 142872108 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (1R,5S)-6,6-dimethyl-2-propan-2-ylbicyclo[3.1.1]hept-2-ene;ethane |
| SMILES | CC.CC(C)C1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C12H20.C2H6/c1-8(2)10-6-5-9-7-11(10)12(9,3)4;1-2/h6,8-9,11H,5,7H2,1-4H3;1-2H3/t9-,11-;/m0./s1 |
| InChIKey | ZYAFXWBFOXKRLR-ROLPUNSJSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|