C13H19N — CID 123726795
(1R,5S)-2-(2-isocyanopropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 123726795) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (1R,5S)-2-(2-isocyanopropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
| Compound Name | (1R,5S)-2-(2-isocyanopropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
|---|---|
| PubChem CID | 123726795 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1R,5S)-2-(2-isocyanopropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | [C-]#[N+]C(C)CC1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C13H19N/c1-9(14-4)7-10-5-6-11-8-12(10)13(11,2)3/h5,9,11-12H,6-8H2,1-3H3/t9?,11-,12-/m0/s1 |
| InChIKey | LLFLSWXQJQUREW-WEBCLNCGSA-N |
| XLogP | 3.68 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|