C13H24Si — CID 10987502
[(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl-trimethylsilane (PubChem CID 10987502) has the molecular formula C13H24Si and a molecular weight of 208.42 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl-trimethylsilane.
| Compound Name | [(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10987502 |
| Molecular Formula | C13H24Si |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl-trimethylsilane |
| SMILES | CC1(C)[C@@H]2CC(C[Si](C)(C)C)=C[C@H]1C2 |
| InChI | InChI=1S/C13H24Si/c1-13(2)11-6-10(7-12(13)8-11)9-14(3,4)5/h6,11-12H,7-9H2,1-5H3/t11-,12+/m0/s1 |
| InChIKey | QQFMTSVBSOAETC-NWDGAFQWSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|