C25H31BrN+ — CID 71519665
[4-(2-bromophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium (PubChem CID 71519665) has the molecular formula C25H31BrN+ and a molecular weight of 425.43 g/mol. Its IUPAC name is [4-(2-bromophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium.
| Compound Name | [4-(2-bromophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 71519665 |
| Molecular Formula | C25H31BrN+ |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [4-(2-bromophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium |
| SMILES | CC1(C)[C@@H]2CC(C[N+](C)(C)Cc3ccc(-c4ccccc4Br)cc3)=C[C@H]1C2 |
| InChI | InChI=1S/C25H31BrN/c1-25(2)21-13-19(14-22(25)15-21)17-27(3,4)16-18-9-11-20(12-10-18)23-7-5-6-8-24(23)26/h5-13,21-22H,14-17H2,1-4H3/q+1/t21-,22+/m0/s1 |
| InChIKey | GUNSZRXDCPXJIZ-FCHUYYIVSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|