About dibenzyl(dimethyl)azanium;hydrate;hydrochloride
dibenzyl(dimethyl)azanium;hydrate;hydrochloride (PubChem CID 126959891) has the molecular formula C16H23ClNO+
and a molecular weight of 280.82 g/mol. Its IUPAC name is dibenzyl(dimethyl)azanium;hydrate;hydrochloride.
Molecular Properties
| Compound Name | dibenzyl(dimethyl)azanium;hydrate;hydrochloride |
| PubChem CID | 126959891 |
| Molecular Formula | C16H23ClNO+ |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | dibenzyl(dimethyl)azanium;hydrate;hydrochloride |
| SMILES | C[N+](C)(Cc1ccccc1)Cc1ccccc1.Cl.O |
| InChI | InChI=1S/C16H20N.ClH.H2O/c1-17(2,13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16;;/h3-12H,13-14H2,1-2H3;1H;1H2/q+1;; |
| InChIKey | JSNYYIWJLBQGOL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl(dimethyl)azanium;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl(dimethyl)azanium;hydrate;hydrochloride?
The IUPAC name of dibenzyl(dimethyl)azanium;hydrate;hydrochloride (CID 126959891) is dibenzyl(dimethyl)azanium;hydrate;hydrochloride.
What is the SMILES notation for dibenzyl(dimethyl)azanium;hydrate;hydrochloride?
The canonical SMILES for dibenzyl(dimethyl)azanium;hydrate;hydrochloride is C[N+](C)(Cc1ccccc1)Cc1ccccc1.Cl.O.
What is the InChIKey of dibenzyl(dimethyl)azanium;hydrate;hydrochloride?
The InChIKey is JSNYYIWJLBQGOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N.ClH.H2O/c1-17(2,13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16;;/h3-12H,13-14H2,1-2H3;1H;1H2/q+1;;.
What are the key properties of dibenzyl(dimethyl)azanium;hydrate;hydrochloride?
dibenzyl(dimethyl)azanium;hydrate;hydrochloride has a molecular weight of 280.82 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl(dimethyl)azanium;hydrate;hydrochloride is sourced from PubChem (CID 126959891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).