About benzyl-ethyl-dimethylazanium;mercury;chloride
benzyl-ethyl-dimethylazanium;mercury;chloride (PubChem CID 174604450) has the molecular formula C11H18ClHgN
and a molecular weight of 400.32 g/mol. Its IUPAC name is benzyl-ethyl-dimethylazanium;mercury;chloride.
Molecular Properties
| Compound Name | benzyl-ethyl-dimethylazanium;mercury;chloride |
| PubChem CID | 174604450 |
| Molecular Formula | C11H18ClHgN |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | benzyl-ethyl-dimethylazanium;mercury;chloride |
| SMILES | CC[N+](C)(C)Cc1ccccc1.[Cl-].[Hg] |
| InChI | InChI=1S/C11H18N.ClH.Hg/c1-4-12(2,3)10-11-8-6-5-7-9-11;;/h5-9H,4,10H2,1-3H3;1H;/q+1;;/p-1 |
| InChIKey | JPHHVXQSEBGBQS-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl-ethyl-dimethylazanium;mercury;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-ethyl-dimethylazanium;mercury;chloride?
The IUPAC name of benzyl-ethyl-dimethylazanium;mercury;chloride (CID 174604450) is benzyl-ethyl-dimethylazanium;mercury;chloride.
What is the SMILES notation for benzyl-ethyl-dimethylazanium;mercury;chloride?
The canonical SMILES for benzyl-ethyl-dimethylazanium;mercury;chloride is CC[N+](C)(C)Cc1ccccc1.[Cl-].[Hg].
What is the InChIKey of benzyl-ethyl-dimethylazanium;mercury;chloride?
The InChIKey is JPHHVXQSEBGBQS-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H18N.ClH.Hg/c1-4-12(2,3)10-11-8-6-5-7-9-11;;/h5-9H,4,10H2,1-3H3;1H;/q+1;;/p-1.
What are the key properties of benzyl-ethyl-dimethylazanium;mercury;chloride?
benzyl-ethyl-dimethylazanium;mercury;chloride has a molecular weight of 400.32 g/mol, XLogP of -0.72, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-ethyl-dimethylazanium;mercury;chloride is sourced from PubChem (CID 174604450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).