About benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride
benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride (PubChem CID 173433329) has the molecular formula C12H19Cl2N
and a molecular weight of 248.20 g/mol. Its IUPAC name is benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride.
Molecular Properties
| Compound Name | benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride |
| PubChem CID | 173433329 |
| Molecular Formula | C12H19Cl2N |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride |
| SMILES | C=CC[N+](C)(C)Cc1ccccc1.Cl.[Cl-] |
| InChI | InChI=1S/C12H18N.2ClH/c1-4-10-13(2,3)11-12-8-6-5-7-9-12;;/h4-9H,1,10-11H2,2-3H3;2*1H/q+1;;/p-1 |
| InChIKey | SBQPMLCLHCKDRC-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride?
The IUPAC name of benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride (CID 173433329) is benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride.
What is the SMILES notation for benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride?
The canonical SMILES for benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride is C=CC[N+](C)(C)Cc1ccccc1.Cl.[Cl-].
What is the InChIKey of benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride?
The InChIKey is SBQPMLCLHCKDRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H18N.2ClH/c1-4-10-13(2,3)11-12-8-6-5-7-9-12;;/h4-9H,1,10-11H2,2-3H3;2*1H/q+1;;/p-1.
What are the key properties of benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride?
benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride has a molecular weight of 248.20 g/mol, XLogP of -0.13, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-dimethyl-prop-2-enylazanium;chloride;hydrochloride is sourced from PubChem (CID 173433329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).