C14H20ClNO2 — CID 174771371
benzyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium chloride (PubChem CID 174771371) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is benzyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium chloride.
| Compound Name | benzyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 174771371 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | benzyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium chloride |
| SMILES | C=CC(=O)C(O)C[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C14H20NO2.ClH/c1-4-13(16)14(17)11-15(2,3)10-12-8-6-5-7-9-12;/h4-9,14,17H,1,10-11H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | IBXJYEQNCSRRSY-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|