C22H26NO3+ — CID 174378368
2-(4-benzoylphenyl)ethyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium (PubChem CID 174378368) has the molecular formula C22H26NO3+ and a molecular weight of 352.45 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)ethyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium.
| Compound Name | 2-(4-benzoylphenyl)ethyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium |
|---|---|
| PubChem CID | 174378368 |
| Molecular Formula | C22H26NO3+ |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-(4-benzoylphenyl)ethyl-(2-hydroxy-3-oxopent-4-enyl)-dimethylazanium |
| SMILES | C=CC(=O)C(O)C[N+](C)(C)CCc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26NO3/c1-4-20(24)21(25)16-23(2,3)15-14-17-10-12-19(13-11-17)22(26)18-8-6-5-7-9-18/h4-13,21,25H,1,14-16H2,2-3H3/q+1 |
| InChIKey | IXZKSLCPQQHUDU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|