C19H22ClNO3 — CID 175497028
[4-[(dimethylamino)methyl]phenyl]-phenylmethanone;prop-2-enoic acid;hydrochloride (PubChem CID 175497028) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]phenyl]-phenylmethanone;prop-2-enoic acid;hydrochloride.
| Compound Name | [4-[(dimethylamino)methyl]phenyl]-phenylmethanone;prop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 175497028 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [4-[(dimethylamino)methyl]phenyl]-phenylmethanone;prop-2-enoic acid;hydrochloride |
| SMILES | C=CC(=O)O.CN(C)Cc1ccc(C(=O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C16H17NO.C3H4O2.ClH/c1-17(2)12-13-8-10-15(11-9-13)16(18)14-6-4-3-5-7-14;1-2-3(4)5;/h3-11H,12H2,1-2H3;2H,1H2,(H,4,5);1H |
| InChIKey | NLCWMIPTIXNLNE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|