About (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride
(4-benzoylphenyl)methyl-trimethylazanium;propane;chloride (PubChem CID 174849581) has the molecular formula C20H28ClNO
and a molecular weight of 333.90 g/mol. Its IUPAC name is (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride.
Molecular Properties
| Compound Name | (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride |
| PubChem CID | 174849581 |
| Molecular Formula | C20H28ClNO |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride |
| SMILES | CCC.C[N+](C)(C)Cc1ccc(C(=O)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C17H20NO.C3H8.ClH/c1-18(2,3)13-14-9-11-16(12-10-14)17(19)15-7-5-4-6-8-15;1-3-2;/h4-12H,13H2,1-3H3;3H2,1-2H3;1H/q+1;;/p-1 |
| InChIKey | HYSVUHHYMCBSEW-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride?
The IUPAC name of (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride (CID 174849581) is (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride.
What is the SMILES notation for (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride?
The canonical SMILES for (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride is CCC.C[N+](C)(C)Cc1ccc(C(=O)c2ccccc2)cc1.[Cl-].
What is the InChIKey of (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride?
The InChIKey is HYSVUHHYMCBSEW-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H20NO.C3H8.ClH/c1-18(2,3)13-14-9-11-16(12-10-14)17(19)15-7-5-4-6-8-15;1-3-2;/h4-12H,13H2,1-3H3;3H2,1-2H3;1H/q+1;;/p-1.
What are the key properties of (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride?
(4-benzoylphenyl)methyl-trimethylazanium;propane;chloride has a molecular weight of 333.90 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzoylphenyl)methyl-trimethylazanium;propane;chloride is sourced from PubChem (CID 174849581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).