C28H44N2O6+2 — CID 87375820
bis(benzyl-(2-hydroxypropyl)-dimethylazanium);(E)-but-2-enedioic acid (PubChem CID 87375820) has the molecular formula C28H44N2O6+2 and a molecular weight of 504.67 g/mol. Its IUPAC name is bis(benzyl-(2-hydroxypropyl)-dimethylazanium);(E)-but-2-enedioic acid.
| Compound Name | bis(benzyl-(2-hydroxypropyl)-dimethylazanium);(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 87375820 |
| Molecular Formula | C28H44N2O6+2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | bis(benzyl-(2-hydroxypropyl)-dimethylazanium);(E)-but-2-enedioic acid |
| SMILES | CC(O)C[N+](C)(C)Cc1ccccc1.CC(O)C[N+](C)(C)Cc1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C12H20NO.C4H4O4/c2*1-11(14)9-13(2,3)10-12-7-5-4-6-8-12;5-3(6)1-2-4(7)8/h2*4-8,11,14H,9-10H2,1-3H3;1-2H,(H,5,6)(H,7,8)/q2*+1;/b;;2-1+ |
| InChIKey | KCCAXFHFJKGLRI-WXXKFALUSA-N |
| XLogP | 3.00 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|