C20H25N2O3+ — CID 173448558
4-anilino-4-oxobut-2-enoic acid;benzyl(trimethyl)azanium (PubChem CID 173448558) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-anilino-4-oxobut-2-enoic acid;benzyl(trimethyl)azanium.
| Compound Name | 4-anilino-4-oxobut-2-enoic acid;benzyl(trimethyl)azanium |
|---|---|
| PubChem CID | 173448558 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-anilino-4-oxobut-2-enoic acid;benzyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)Cc1ccccc1.O=C(O)C=CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H9NO3.C10H16N/c12-9(6-7-10(13)14)11-8-4-2-1-3-5-8;1-11(2,3)9-10-7-5-4-6-8-10/h1-7H,(H,11,12)(H,13,14);4-8H,9H2,1-3H3/q;+1 |
| InChIKey | WMXOVYHRJRETFL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|