C15H25NO3 — CID 102214052
tert-butyl N-[[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-N-hydroxycarbamate (PubChem CID 102214052) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl N-[[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-N-hydroxycarbamate.
| Compound Name | tert-butyl N-[[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 102214052 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | tert-butyl N-[[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]methyl]-N-hydroxycarbamate |
| SMILES | CC(C)(C)OC(=O)N(O)CC1=C[C@@H]2C[C@H](C1)C2(C)C |
| InChI | InChI=1S/C15H25NO3/c1-14(2,3)19-13(17)16(18)9-10-6-11-8-12(7-10)15(11,4)5/h6,11-12,18H,7-9H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | SRVTYFWQPXNNSW-NEPJUHHUSA-N |
| XLogP | 3.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|