C12H21NO3 — CID 85373698
tert-butyl N-(4-ethylcyclopent-2-en-1-yl)-N-hydroxycarbamate (PubChem CID 85373698) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl N-(4-ethylcyclopent-2-en-1-yl)-N-hydroxycarbamate.
| Compound Name | tert-butyl N-(4-ethylcyclopent-2-en-1-yl)-N-hydroxycarbamate |
|---|---|
| PubChem CID | 85373698 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl N-(4-ethylcyclopent-2-en-1-yl)-N-hydroxycarbamate |
| SMILES | CCC1C=CC(N(O)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H21NO3/c1-5-9-6-7-10(8-9)13(15)11(14)16-12(2,3)4/h6-7,9-10,15H,5,8H2,1-4H3 |
| InChIKey | OCSDVHWJAXEETQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|