About tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate
tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate (PubChem CID 134314514) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate.
Analyze tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate?
The IUPAC name of tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate (CID 134314514) is tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate.
What is the SMILES notation for tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate?
The canonical SMILES for tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate is CCN(C(=O)OC(C)(C)C)C(C)(C)C(C)(C)N.
What is the InChIKey of tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate?
The InChIKey is NSUJXWFJGHCNAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c1-9-15(10(16)17-11(2,3)4)13(7,8)12(5,6)14/h9,14H2,1-8H3.
What are the key properties of tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate?
tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate has a molecular weight of 244.38 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-amino-2,3-dimethylbutan-2-yl)-N-ethylcarbamate is sourced from PubChem (CID 134314514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).