C11H20N2O5 — CID 135140582
tert-butyl N-carbamoyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 135140582) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is tert-butyl N-carbamoyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-carbamoyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 135140582 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | tert-butyl N-carbamoyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(N)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20N2O5/c1-10(2,3)17-8(15)13(7(12)14)9(16)18-11(4,5)6/h1-6H3,(H2,12,14) |
| InChIKey | RUDXNALMPUXCJY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |