C13H25N3O5 — CID 87257784
tert-butyl N-[N'-(2-hydroxyethyl)carbamimidoyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 87257784) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl N-[N'-(2-hydroxyethyl)carbamimidoyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[N'-(2-hydroxyethyl)carbamimidoyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 87257784 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl N-[N'-(2-hydroxyethyl)carbamimidoyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)/C(N)=N/CCO |
| InChI | InChI=1S/C13H25N3O5/c1-12(2,3)20-10(18)16(9(14)15-7-8-17)11(19)21-13(4,5)6/h17H,7-8H2,1-6H3,(H2,14,15) |
| InChIKey | PDLNAJOREUWPSG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|