C14H28N2O5 — CID 11392545
tert-butyl N-(4-hydroxybutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 11392545) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-(4-hydroxybutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(4-hydroxybutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 11392545 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | tert-butyl N-(4-hydroxybutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(CCO)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O5/c1-10(8-9-17)16(12(19)21-14(5,6)7)15-11(18)20-13(2,3)4/h10,17H,8-9H2,1-7H3,(H,15,18) |
| InChIKey | UOMNELYPRIKVPI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|