C16H30N2O4S2 — CID 134919895
methyl 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]butanedithioate (PubChem CID 134919895) has the molecular formula C16H30N2O4S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is methyl 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]butanedithioate.
| Compound Name | methyl 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]butanedithioate |
|---|---|
| PubChem CID | 134919895 |
| Molecular Formula | C16H30N2O4S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]butanedithioate |
| SMILES | CSC(=S)C(C(C)C)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O4S2/c1-10(2)11(12(23)24-9)18(14(20)22-16(6,7)8)17-13(19)21-15(3,4)5/h10-11H,1-9H3,(H,17,19) |
| InChIKey | UJAXJOQYXMURTF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|