C18H35N2O8P — CID 15180519
tert-butyl N-(1-diethoxyphosphoryl-3-oxobutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 15180519) has the molecular formula C18H35N2O8P and a molecular weight of 438.46 g/mol. Its IUPAC name is tert-butyl N-(1-diethoxyphosphoryl-3-oxobutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(1-diethoxyphosphoryl-3-oxobutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 15180519 |
| Molecular Formula | C18H35N2O8P |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | tert-butyl N-(1-diethoxyphosphoryl-3-oxobutan-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CCOP(=O)(CC(C(C)=O)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C18H35N2O8P/c1-10-25-29(24,26-11-2)12-14(13(3)21)20(16(23)28-18(7,8)9)19-15(22)27-17(4,5)6/h14H,10-12H2,1-9H3,(H,19,22) |
| InChIKey | XSLFYMXTOSFRIR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|