C27H36N2O5S — CID 57382112
S-naphthalen-1-yl (E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]hex-2-enethioate (PubChem CID 57382112) has the molecular formula C27H36N2O5S and a molecular weight of 500.66 g/mol. Its IUPAC name is S-naphthalen-1-yl (E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]hex-2-enethioate.
| Compound Name | S-naphthalen-1-yl (E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]hex-2-enethioate |
|---|---|
| PubChem CID | 57382112 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | S-naphthalen-1-yl (E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]hex-2-enethioate |
| SMILES | CC(C)[C@@H](/C=C/C(=O)Sc1cccc2ccccc12)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H36N2O5S/c1-18(2)21(29(25(32)34-27(6,7)8)28-24(31)33-26(3,4)5)16-17-23(30)35-22-15-11-13-19-12-9-10-14-20(19)22/h9-18,21H,1-8H3,(H,28,31)/b17-16+/t21-/m1/s1 |
| InChIKey | CTTKBNVQWDMPMN-LVWMNBHTSA-N |
| XLogP | 6.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|