C14H25N3O6 — CID 87809677
3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]propanoic acid (PubChem CID 87809677) has the molecular formula C14H25N3O6 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]propanoic acid.
| Compound Name | 3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 87809677 |
| Molecular Formula | C14H25N3O6 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)/C(N)=N/CCC(=O)O |
| InChI | InChI=1S/C14H25N3O6/c1-13(2,3)22-11(20)17(12(21)23-14(4,5)6)10(15)16-8-7-9(18)19/h7-8H2,1-6H3,(H2,15,16)(H,18,19) |
| InChIKey | RQGBDVGRTQXANE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|