C17H28INO6 — CID 89422659
(4S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-iodohept-6-enoic acid (PubChem CID 89422659) has the molecular formula C17H28INO6 and a molecular weight of 469.32 g/mol. Its IUPAC name is (4S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-iodohept-6-enoic acid.
| Compound Name | (4S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-iodohept-6-enoic acid |
|---|---|
| PubChem CID | 89422659 |
| Molecular Formula | C17H28INO6 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (4S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-iodohept-6-enoic acid |
| SMILES | C=C(C[C@@H](I)CCC(=O)O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28INO6/c1-11(10-12(18)8-9-13(20)21)19(14(22)24-16(2,3)4)15(23)25-17(5,6)7/h12H,1,8-10H2,2-7H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | RHJSEWWIOFHEMZ-LBPRGKRZSA-N |
| XLogP | 4.73 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|