C17H28N2O10 — CID 175853164
(2S)-2-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetyl]amino]pentanedioic acid (PubChem CID 175853164) has the molecular formula C17H28N2O10 and a molecular weight of 420.42 g/mol. Its IUPAC name is (2S)-2-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175853164 |
| Molecular Formula | C17H28N2O10 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (2S)-2-[[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetyl]amino]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)N(OCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O10/c1-16(2,3)28-14(25)19(15(26)29-17(4,5)6)27-9-11(20)18-10(13(23)24)7-8-12(21)22/h10H,7-9H2,1-6H3,(H,18,20)(H,21,22)(H,23,24)/t10-/m0/s1 |
| InChIKey | YPNGFEXBZZHLCS-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|