C14H25NO6 — CID 175466863
4-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (PubChem CID 175466863) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid.
| Compound Name | 4-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175466863 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| SMILES | CCOC(=O)CN(C(=O)OC(C)(C)C)C(C)CCC(=O)O |
| InChI | InChI=1S/C14H25NO6/c1-6-20-12(18)9-15(10(2)7-8-11(16)17)13(19)21-14(3,4)5/h10H,6-9H2,1-5H3,(H,16,17) |
| InChIKey | CWBLRLNUASXQPC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |