C9H17N3O6 — CID 141080715
ethyl N-(1-amino-1-hydroxy-2-methylpropan-2-yl)oxycarbonyl-N-carbamoylcarbamate (PubChem CID 141080715) has the molecular formula C9H17N3O6 and a molecular weight of 263.25 g/mol. Its IUPAC name is ethyl N-(1-amino-1-hydroxy-2-methylpropan-2-yl)oxycarbonyl-N-carbamoylcarbamate.
| Compound Name | ethyl N-(1-amino-1-hydroxy-2-methylpropan-2-yl)oxycarbonyl-N-carbamoylcarbamate |
|---|---|
| PubChem CID | 141080715 |
| Molecular Formula | C9H17N3O6 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | ethyl N-(1-amino-1-hydroxy-2-methylpropan-2-yl)oxycarbonyl-N-carbamoylcarbamate |
| SMILES | CCOC(=O)N(C(N)=O)C(=O)OC(C)(C)C(N)O |
| InChI | InChI=1S/C9H17N3O6/c1-4-17-7(15)12(6(11)14)8(16)18-9(2,3)5(10)13/h5,13H,4,10H2,1-3H3,(H2,11,14) |
| InChIKey | QGGHRUUZOVERKJ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|