C10H20N2O4 — CID 130748777
tert-butyl N-(2-amino-2-oxoethyl)-N-(2-methoxyethyl)carbamate (PubChem CID 130748777) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl N-(2-amino-2-oxoethyl)-N-(2-methoxyethyl)carbamate.
| Compound Name | tert-butyl N-(2-amino-2-oxoethyl)-N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 130748777 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | tert-butyl N-(2-amino-2-oxoethyl)-N-(2-methoxyethyl)carbamate |
| SMILES | COCCN(CC(N)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O4/c1-10(2,3)16-9(14)12(5-6-15-4)7-8(11)13/h5-7H2,1-4H3,(H2,11,13) |
| InChIKey | RVDNSWCRIGGYBM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |