C16H34N2O3 — CID 103906265
tert-butyl N-(2-methoxyethyl)-N-[2-(2-methylpentan-3-ylamino)ethyl]carbamate (PubChem CID 103906265) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is tert-butyl N-(2-methoxyethyl)-N-[2-(2-methylpentan-3-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-(2-methoxyethyl)-N-[2-(2-methylpentan-3-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 103906265 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | tert-butyl N-(2-methoxyethyl)-N-[2-(2-methylpentan-3-ylamino)ethyl]carbamate |
| SMILES | CCC(NCCN(CCOC)C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H34N2O3/c1-8-14(13(2)3)17-9-10-18(11-12-20-7)15(19)21-16(4,5)6/h13-14,17H,8-12H2,1-7H3 |
| InChIKey | ZHSPCZMVWKUFSF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |