C17H30N2O3S — CID 103906226
tert-butyl N-(2-methoxyethyl)-N-[2-(1-thiophen-2-ylpropylamino)ethyl]carbamate (PubChem CID 103906226) has the molecular formula C17H30N2O3S and a molecular weight of 342.50 g/mol. Its IUPAC name is tert-butyl N-(2-methoxyethyl)-N-[2-(1-thiophen-2-ylpropylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-(2-methoxyethyl)-N-[2-(1-thiophen-2-ylpropylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 103906226 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | tert-butyl N-(2-methoxyethyl)-N-[2-(1-thiophen-2-ylpropylamino)ethyl]carbamate |
| SMILES | CCC(NCCN(CCOC)C(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C17H30N2O3S/c1-6-14(15-8-7-13-23-15)18-9-10-19(11-12-21-5)16(20)22-17(2,3)4/h7-8,13-14,18H,6,9-12H2,1-5H3 |
| InChIKey | DNHHCRVDUYAKSJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |