C16H27BrN2O2S — CID 107246033
tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]ethyl]-N-propylcarbamate (PubChem CID 107246033) has the molecular formula C16H27BrN2O2S and a molecular weight of 391.38 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 107246033 |
| Molecular Formula | C16H27BrN2O2S |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | tert-butyl N-[2-[1-(3-bromothiophen-2-yl)ethylamino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCNC(C)c1sccc1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27BrN2O2S/c1-6-9-19(15(20)21-16(3,4)5)10-8-18-12(2)14-13(17)7-11-22-14/h7,11-12,18H,6,8-10H2,1-5H3 |
| InChIKey | XMLNAERYTQFCHJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |